cas: 137553-43-6 — see every product listed under this CAS number, including other names
DHFR-IN-3 95% (CAS 137553-43-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A163566-250mg |
| cas | 137553-43-6 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 225.75 Pln | |
| Ambeed | 1g | 292.50 Pln | |
| Ambeed | 5g | 1165.81 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A163566 |
7-bromoquinazoline-2,4-diamine (CAS 137553-43-6) is a chemical compound with the molecular formula C8H7BrN4 and a molecular weight of 239.07 g/mol. IUPAC name: 7-bromoquinazoline-2,4-diamine. InChIKey: YPWBLOIRVSSESG-UHFFFAOYSA-N.
| Molecular formula | C8H7BrN4 |
|---|---|
| Molecular weight | 239.07 g/mol |
| IUPAC name | 7-bromoquinazoline-2,4-diamine |
| InChIKey | YPWBLOIRVSSESG-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Br)N=C(N=C2N)N |
Computed by PubChem (NCBI)