cas: 696641-73-3 — see every product listed under this CAS number, including other names
DL-Ăź-(3,4-Dimethoxyphenyl)alanine, 98% (CAS 696641-73-3) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F034416-5G |
| cas | 696641-73-3 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 154.13 Pln | |
| Fluorochem | 10g | 232.23 Pln | |
| Fluorochem | 25g | 414.46 Pln | |
| Fluorochem | 100g | 1471.37 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
(3S)-3-amino-3-(3,4-dimethoxyphenyl)propanoic acid (CAS 696641-73-3) is a chemical compound with the molecular formula C11H15NO4 and a molecular weight of 225.24 g/mol. IUPAC name: (3S)-3-amino-3-(3,4-dimethoxyphenyl)propanoic acid. InChIKey: FGCXSFRGPCUBPW-QMMMGPOBSA-N.
| Molecular formula | C11H15NO4 |
|---|---|
| Molecular weight | 225.24 g/mol |
| IUPAC name | (3S)-3-amino-3-(3,4-dimethoxyphenyl)propanoic acid |
| InChIKey | FGCXSFRGPCUBPW-QMMMGPOBSA-N |
| SMILES | COC1=C(C=C(C=C1)[C@H](CC(=O)O)N)OC |
Computed by PubChem (NCBI)