cas: 77284-64-1 — see every product listed under this CAS number, including other names
DL-Boc-Aminobutyric acid, 97% (CAS 77284-64-1) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g, 1g, 50g. Offered by: Fluorochem, Chemat.
| brand | Fluorochem |
|---|---|
| catalog number | F552150-5G |
| cas | 77284-64-1 |
| size | 5g |
| availability | In Stock China |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 164.54 Pln | |
| Fluorochem | 10g | 242.64 Pln | |
| Fluorochem | 25g | 523.79 Pln | |
| Fluorochem | 100g | 1893.10 Pln | |
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 126.80 Pln | |
| Chemat | 10g | 184.40 Pln | |
| Chemat | 25g | 371.60 Pln | |
| Chemat | 50g | 635.60 Pln | |
| Chemat | 100g | 1120.40 Pln |
| purity | 97% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 2-3 weeks |
| category | Odczynniki chemiczne |
2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid (CAS 77284-64-1) is a chemical compound with the molecular formula C9H17NO4 and a molecular weight of 203.24 g/mol. IUPAC name: 2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid. InChIKey: PNFVIPIQXAIUAY-UHFFFAOYSA-N.
| Molecular formula | C9H17NO4 |
|---|---|
| Molecular weight | 203.24 g/mol |
| IUPAC name | 2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid |
| InChIKey | PNFVIPIQXAIUAY-UHFFFAOYSA-N |
| SMILES | CCC(C(=O)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)