CAS 34306-42-8 appears in our catalog under these names: Boc–L–2–aminobutanoic acid, Boc-L-2Abu-OH, (S)-2-(Boc-amino)butyric acid, 95% , (S)-2-(tert-Butoxycarbonylamino)butyric Acid, >98.0%(HPLC)(T), Boc-Abu-OH 97%. Offered by: GLPBio, Iris Biotech, Thermo Scientific (Alfa Aesar), TCI, Ambeed. Available pack sizes: 5g, 25g, 1g, 10g, 100g, 500g, 1000g, 1kg.
(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid (CAS 34306-42-8) is a chemical compound with the molecular formula C9H17NO4 and a molecular weight of 203.24 g/mol. IUPAC name: (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid. InChIKey: PNFVIPIQXAIUAY-LURJTMIESA-N.
| Molecular formula | C9H17NO4 |
|---|---|
| Molecular weight | 203.24 g/mol |
| IUPAC name | (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid |
| InChIKey | PNFVIPIQXAIUAY-LURJTMIESA-N |
| SMILES | CC[C@@H](C(=O)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)