CAS 74226-22-5 appears in our catalog under these names: Dazoxiben, Dazoxiben/ 99.94% (existing batch purity), 4-(2-(1H-Imidazol-1-yl)ethoxy)benzoic acid hydrochloride, Dazoxiben HCl 97%, 4-(2-(1H-Imidazol-1-yl)ethoxy)benzoic acid hydrochloride, 97%, 97%. Offered by: GLPBio, TargetMol, Biosynth, Ambeed, Chemat. Available pack sizes: 5mg, 1mg, 2mg, 10mg, 25mg, 50mg, 100mg, 500mg.
4-(2-imidazol-1-ylethoxy)benzoic acid;hydrochloride (CAS 74226-22-5) is a chemical compound with the molecular formula C12H13ClN2O3 and a molecular weight of 268.69 g/mol. IUPAC name: 4-(2-imidazol-1-ylethoxy)benzoic acid;hydrochloride. InChIKey: PVKDFUXBDJPRGU-UHFFFAOYSA-N.
| Molecular formula | C12H13ClN2O3 |
|---|---|
| Molecular weight | 268.69 g/mol |
| IUPAC name | 4-(2-imidazol-1-ylethoxy)benzoic acid;hydrochloride |
| InChIKey | PVKDFUXBDJPRGU-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)O)OCCN2C=CN=C2.Cl |
Computed by PubChem (NCBI)