cas: 1579-40-4 — see every product listed under this CAS number, including other names
Di-p-tolyl Ether, >98.0%(GC) (CAS 1579-40-4) is a chemical reagent available from Chemat. Available pack sizes: 25g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | D2178-25G |
| cas | 1579-40-4 |
| size | 25g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 25g | 516.64 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(GC) |
1-methyl-4-(4-methylphenoxy)benzene (CAS 1579-40-4) is a chemical compound with the molecular formula C14H14O and a molecular weight of 198.26 g/mol. IUPAC name: 1-methyl-4-(4-methylphenoxy)benzene. InChIKey: YWYHGNUFMPSTTR-UHFFFAOYSA-N.
| Molecular formula | C14H14O |
|---|---|
| Molecular weight | 198.26 g/mol |
| IUPAC name | 1-methyl-4-(4-methylphenoxy)benzene |
| InChIKey | YWYHGNUFMPSTTR-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)OC2=CC=C(C=C2)C |
Computed by PubChem (NCBI)