cas: 1579-40-4 — see every product listed under this CAS number, including other names
4,4'-Oxybis(methylbenzene), 95% (CAS 1579-40-4) is a chemical reagent available from Chemat. Available pack sizes: 5g, 1g, 25g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F235739-5G |
| cas | 1579-40-4 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 102.07 Pln | |
| Fluorochem | 1g | 102.07 Pln | |
| Fluorochem | 25g | 128.10 Pln | |
| Fluorochem | 10g | 128.10 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
1-methyl-4-(4-methylphenoxy)benzene (CAS 1579-40-4) is a chemical compound with the molecular formula C14H14O and a molecular weight of 198.26 g/mol. IUPAC name: 1-methyl-4-(4-methylphenoxy)benzene. InChIKey: YWYHGNUFMPSTTR-UHFFFAOYSA-N.
| Molecular formula | C14H14O |
|---|---|
| Molecular weight | 198.26 g/mol |
| IUPAC name | 1-methyl-4-(4-methylphenoxy)benzene |
| InChIKey | YWYHGNUFMPSTTR-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)OC2=CC=C(C=C2)C |
Computed by PubChem (NCBI)