cas: 5448-16-8 — see every product listed under this CAS number, including other names
Diethyl 3-methyl-1H-pyrrole-2,4-dicarboxylate, 97%, 97% (CAS 5448-16-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11DB6Q-100mg |
| cas | 5448-16-8 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 150.80 Pln | |
| Chemat | 250mg | 203.60 Pln | |
| Chemat | 1g | 486.80 Pln | |
| Chemat | 5g | 1336.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Diethyl 3-methyl-1H-pyrrole-2,4-dicarboxylate (CAS 5448-16-8) is a chemical compound with the molecular formula C11H15NO4 and a molecular weight of 225.24 g/mol. IUPAC name: diethyl 3-methyl-1H-pyrrole-2,4-dicarboxylate. InChIKey: KJPYNVNXXUELAB-UHFFFAOYSA-N.
| Molecular formula | C11H15NO4 |
|---|---|
| Molecular weight | 225.24 g/mol |
| IUPAC name | diethyl 3-methyl-1H-pyrrole-2,4-dicarboxylate |
| InChIKey | KJPYNVNXXUELAB-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CNC(=C1C)C(=O)OCC |
Computed by PubChem (NCBI)