cas: 5448-16-8 — see every product listed under this CAS number, including other names
Diethyl 3-methyl-1H-pyrrole-2,4-dicarboxylate, 97% (CAS 5448-16-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F234221-100MG |
| cas | 5448-16-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 221.81 Pln | |
| Fluorochem | 250mg | 310.33 Pln | |
| Fluorochem | 1g | 778.91 Pln | |
| Fluorochem | 5g | 2189.87 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Diethyl 3-methyl-1H-pyrrole-2,4-dicarboxylate (CAS 5448-16-8) is a chemical compound with the molecular formula C11H15NO4 and a molecular weight of 225.24 g/mol. IUPAC name: diethyl 3-methyl-1H-pyrrole-2,4-dicarboxylate. InChIKey: KJPYNVNXXUELAB-UHFFFAOYSA-N.
| Molecular formula | C11H15NO4 |
|---|---|
| Molecular weight | 225.24 g/mol |
| IUPAC name | diethyl 3-methyl-1H-pyrrole-2,4-dicarboxylate |
| InChIKey | KJPYNVNXXUELAB-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CNC(=C1C)C(=O)OCC |
Computed by PubChem (NCBI)