cas: 1568-83-8 — see every product listed under this CAS number, including other names
Dimethyl-bisphenol A, 95%, 95% (CAS 1568-83-8) is a chemical reagent available from Chemat. Available pack sizes: 25mg, 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112P1V-25mg |
| cas | 1568-83-8 |
| size | 25mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 25mg | 266.00 Pln | |
| Chemat | 100mg | 587.60 Pln | |
| Chemat | 250mg | 947.60 Pln | |
| Chemat | 1g | 2416.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
1-methoxy-4-[2-(4-methoxyphenyl)propan-2-yl]benzene (CAS 1568-83-8) is a chemical compound with the molecular formula C17H20O2 and a molecular weight of 256.34 g/mol. IUPAC name: 1-methoxy-4-[2-(4-methoxyphenyl)propan-2-yl]benzene. InChIKey: OJYIBEYSBXIQOP-UHFFFAOYSA-N.
| Molecular formula | C17H20O2 |
|---|---|
| Molecular weight | 256.34 g/mol |
| IUPAC name | 1-methoxy-4-[2-(4-methoxyphenyl)propan-2-yl]benzene |
| InChIKey | OJYIBEYSBXIQOP-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=CC=C(C=C1)OC)C2=CC=C(C=C2)OC |
Computed by PubChem (NCBI)