cas: 1568-83-8 — see every product listed under this CAS number, including other names
Dimethyl-bisphenol A, 99.78% (CAS 1568-83-8) is a chemical reagent available from Chemat. Available pack sizes: 10mM/1mL, 250 mg, 100 mg. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-115746-10mM/1mL |
| cas | 1568-83-8 |
| size | 10mM/1mL |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 10mM/1mL | 1123.10 Pln | |
| MedChemExpress | 250 mg | 1847.57 Pln | |
| MedChemExpress | 100 mg | 1030.22 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 99.78% |
1-methoxy-4-[2-(4-methoxyphenyl)propan-2-yl]benzene (CAS 1568-83-8) is a chemical compound with the molecular formula C17H20O2 and a molecular weight of 256.34 g/mol. IUPAC name: 1-methoxy-4-[2-(4-methoxyphenyl)propan-2-yl]benzene. InChIKey: OJYIBEYSBXIQOP-UHFFFAOYSA-N.
| Molecular formula | C17H20O2 |
|---|---|
| Molecular weight | 256.34 g/mol |
| IUPAC name | 1-methoxy-4-[2-(4-methoxyphenyl)propan-2-yl]benzene |
| InChIKey | OJYIBEYSBXIQOP-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=CC=C(C=C1)OC)C2=CC=C(C=C2)OC |
Computed by PubChem (NCBI)