Products 537-67-7
CAS 537-67-7 appears in our catalog under these names: Diphenylamine hydrochloride, 98%, Diphenylamine Hydrochloride/ 98%, Diphenylamine hydrochloride, Diphenylamine Hydrochloride, >99.0%(HPLC)(N), Benzenamine, N-phenyl-, hydrochloride (1:1), 97%, 97%. Offered by: Combi-blocks, TargetMol, GLPBio, TCI, Chemat. Available pack sizes: 25g, 100g, 5g, 1g, 500mg, 50g, 500 mg, 1 g.
N-phenylaniline;hydrochloride (CAS 537-67-7) is a chemical compound with the molecular formula C12H12ClN and a molecular weight of 205.68 g/mol. IUPAC name: N-phenylaniline;hydrochloride. InChIKey: JEFJSEIUEJBMSR-UHFFFAOYSA-N.
| Molecular formula | C12H12ClN |
|---|---|
| Molecular weight | 205.68 g/mol |
| IUPAC name | N-phenylaniline;hydrochloride |
| InChIKey | JEFJSEIUEJBMSR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NC2=CC=CC=C2.Cl |
Computed by PubChem (NCBI)
Synonyms:
Diphenylamine hydrochloride, Diphenylammonium chloride, Benzenamine, N-phenyl-, hydrochloride, Diphenylamine, hydrochloride, DIPHENYLAMINE HYDROCHLORIDE [MI], Diphenylamine, hydrochloride (8CI), N-phenylaniline hydrochloride, DIPHENYLAMINE HCL, N-phenylaniline;hydrochloride, Diphenylamine (hydrochloride)