ETHYL 3,5-DIBROMOISONICOTINATE, 98%
cas: 1214375-76-4 — see every product listed under this CAS number, including other names
ETHYL 3,5-DIBROMOISONICOTINATE, 98% (CAS 1214375-76-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch1125X2-100mg |
| cas | 1214375-76-4 |
| size | 100mg |
| availability | 30g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 362.00 Pln | |
| Chemat | 250mg | 563.60 Pln | |
| Chemat | 1g | 899.60 Pln | |
| Chemat | 5g | 2402.00 Pln | |
| Chemat | 10g | 4336.40 Pln | |
| Fluorochem | 100mg | 461.31 Pln | |
| Fluorochem | 250mg | 726.85 Pln | |
| Fluorochem | 1g | 1153.78 Pln | |
| Fluorochem | 5g | 3101.01 Pln | |
| Fluorochem | 10g | 4949.32 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Ethyl 3,5-dibromopyridine-4-carboxylate (CAS 1214375-76-4) is a chemical compound with the molecular formula C8H7Br2NO2 and a molecular weight of 308.95 g/mol. IUPAC name: ethyl 3,5-dibromopyridine-4-carboxylate. InChIKey: KWKKIQCPLDQVFV-UHFFFAOYSA-N.
| Molecular formula | C8H7Br2NO2 |
|---|---|
| Molecular weight | 308.95 g/mol |
| IUPAC name | ethyl 3,5-dibromopyridine-4-carboxylate |
| InChIKey | KWKKIQCPLDQVFV-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C=NC=C1Br)Br |
Computed by PubChem (NCBI)