cas: 773134-84-2 — see every product listed under this CAS number, including other names
Ethyl 1-bromo-2-naphthoate 98% (CAS 773134-84-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1146422-1g |
| cas | 773134-84-2 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 120.06 Pln | |
| Ambeed | 5g | 253.56 Pln | |
| Ambeed | 10g | 381.50 Pln | |
| Ambeed | 25g | 848.75 Pln | |
| Ambeed | 100g | 2567.56 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A1146422 |
Ethyl 1-bromonaphthalene-2-carboxylate (CAS 773134-84-2) is a chemical compound with the molecular formula C13H11BrO2 and a molecular weight of 279.13 g/mol. IUPAC name: ethyl 1-bromonaphthalene-2-carboxylate. InChIKey: TXDQMAGPAKABJU-UHFFFAOYSA-N.
| Molecular formula | C13H11BrO2 |
|---|---|
| Molecular weight | 279.13 g/mol |
| IUPAC name | ethyl 1-bromonaphthalene-2-carboxylate |
| InChIKey | TXDQMAGPAKABJU-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C2=CC=CC=C2C=C1)Br |
Computed by PubChem (NCBI)