cas: 773134-84-2 — see every product listed under this CAS number, including other names
Ethyl 1-bromo-2-naphthoate, 98%, 98% (CAS 773134-84-2) is a chemical reagent available from Chemat. Available pack sizes: 25g, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11G9DX-25g |
| cas | 773134-84-2 |
| size | 25g |
| availability | 150g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 25g | 626.00 Pln | |
| Chemat | 1g | 93.20 Pln | |
| Chemat | 5g | 203.60 Pln | |
| Chemat | 10g | 290.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Ethyl 1-bromonaphthalene-2-carboxylate (CAS 773134-84-2) is a chemical compound with the molecular formula C13H11BrO2 and a molecular weight of 279.13 g/mol. IUPAC name: ethyl 1-bromonaphthalene-2-carboxylate. InChIKey: TXDQMAGPAKABJU-UHFFFAOYSA-N.
| Molecular formula | C13H11BrO2 |
|---|---|
| Molecular weight | 279.13 g/mol |
| IUPAC name | ethyl 1-bromonaphthalene-2-carboxylate |
| InChIKey | TXDQMAGPAKABJU-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C2=CC=CC=C2C=C1)Br |
Computed by PubChem (NCBI)