cas: 939812-72-3 — see every product listed under this CAS number, including other names
Ethyl 2,6-difluoronicotinate, 98% (CAS 939812-72-3) is a chemical reagent available from Chemat. Available pack sizes: 10g, 5g, 25g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A1708372-10g |
| cas | 939812-72-3 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 13187.65 Pln | |
| AmBeed | 5g | 7771.33 Pln | |
| AmBeed | 25g | 25882.15 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
Ethyl 2,6-difluoropyridine-3-carboxylate (CAS 939812-72-3) is a chemical compound with the molecular formula C8H7F2NO2 and a molecular weight of 187.14 g/mol. IUPAC name: ethyl 2,6-difluoropyridine-3-carboxylate. InChIKey: CNOMLDPEQNKUCC-UHFFFAOYSA-N.
| Molecular formula | C8H7F2NO2 |
|---|---|
| Molecular weight | 187.14 g/mol |
| IUPAC name | ethyl 2,6-difluoropyridine-3-carboxylate |
| InChIKey | CNOMLDPEQNKUCC-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(N=C(C=C1)F)F |
Computed by PubChem (NCBI)