CAS 144267-97-0 appears in our catalog under these names: ethyl2–bromo–4,5–difluorobenzoate, Ethyl 2-Bromo-4,5-difluorobenzoate, 95%, 95%, Ethyl 2-bromo-4,5-difluorobenzoate, 98%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 1g, 10g, 100g.
Ethyl 2-bromo-4,5-difluorobenzoate (CAS 144267-97-0) is a chemical compound with the molecular formula C9H7BrF2O2 and a molecular weight of 265.05 g/mol. IUPAC name: ethyl 2-bromo-4,5-difluorobenzoate. InChIKey: JPLCUBDTWNDHCL-UHFFFAOYSA-N.
| Molecular formula | C9H7BrF2O2 |
|---|---|
| Molecular weight | 265.05 g/mol |
| IUPAC name | ethyl 2-bromo-4,5-difluorobenzoate |
| InChIKey | JPLCUBDTWNDHCL-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=C(C=C1Br)F)F |
Computed by PubChem (NCBI)