cas: 1214375-76-4 — see every product listed under this CAS number, including other names
Ethyl 3,5-dibromoisonicotinate, 98%, 98% (CAS 1214375-76-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1125X2-1g |
| cas | 1214375-76-4 |
| size | 1g |
| availability | 35g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 899.60 Pln | |
| Chemat | 5g | 2402.00 Pln | |
| Chemat | 100mg | 362.00 Pln | |
| Chemat | 250mg | 563.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Ethyl 3,5-dibromopyridine-4-carboxylate (CAS 1214375-76-4) is a chemical compound with the molecular formula C8H7Br2NO2 and a molecular weight of 308.95 g/mol. IUPAC name: ethyl 3,5-dibromopyridine-4-carboxylate. InChIKey: KWKKIQCPLDQVFV-UHFFFAOYSA-N.
| Molecular formula | C8H7Br2NO2 |
|---|---|
| Molecular weight | 308.95 g/mol |
| IUPAC name | ethyl 3,5-dibromopyridine-4-carboxylate |
| InChIKey | KWKKIQCPLDQVFV-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C=NC=C1Br)Br |
Computed by PubChem (NCBI)