cas: 1214375-76-4 — see every product listed under this CAS number, including other names
Ethyl 3,5-dibromoisonicotinate, 98% (CAS 1214375-76-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F601047-100MG |
| cas | 1214375-76-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 435.28 Pln | |
| Fluorochem | 250mg | 690.40 Pln | |
| Fluorochem | 1g | 1101.71 Pln | |
| Fluorochem | 5g | 2970.85 Pln | |
| Fluorochem | 10g | 4798.33 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Ethyl 3,5-dibromopyridine-4-carboxylate (CAS 1214375-76-4) is a chemical compound with the molecular formula C8H7Br2NO2 and a molecular weight of 308.95 g/mol. IUPAC name: ethyl 3,5-dibromopyridine-4-carboxylate. InChIKey: KWKKIQCPLDQVFV-UHFFFAOYSA-N.
| Molecular formula | C8H7Br2NO2 |
|---|---|
| Molecular weight | 308.95 g/mol |
| IUPAC name | ethyl 3,5-dibromopyridine-4-carboxylate |
| InChIKey | KWKKIQCPLDQVFV-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C=NC=C1Br)Br |
Computed by PubChem (NCBI)