Ethyl 4-(aminomethyl)benzoate hydrochloride, 97%
cas: 6232-12-8 — see every product listed under this CAS number, including other names
Ethyl 4-(aminomethyl)benzoate hydrochloride, 97% (CAS 6232-12-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A230197-250mg |
| cas | 6232-12-8 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 125.62 Pln | |
| Ambeed | 1g | 131.19 Pln | |
| Ambeed | 5g | 203.50 Pln | |
| Ambeed | 25g | 492.75 Pln | |
| Chemat | 250mg | 74.00 Pln | |
| Chemat | 1g | 74.00 Pln | |
| Chemat | 5g | 126.80 Pln | |
| Chemat | 25g | 280.40 Pln | |
| BLDpharm | 250mg | 125.54 Pln | |
| BLDpharm | 1g | 136.64 Pln | |
| BLDpharm | 5g | 214.39 Pln | |
| BLDpharm | 25g | 525.40 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
Ethyl 4-(aminomethyl)benzoate;hydrochloride (CAS 6232-12-8) is a chemical compound with the molecular formula C10H14ClNO2 and a molecular weight of 215.67 g/mol. IUPAC name: ethyl 4-(aminomethyl)benzoate;hydrochloride. InChIKey: KMZNTLYGVGINKN-UHFFFAOYSA-N.
| Molecular formula | C10H14ClNO2 |
|---|---|
| Molecular weight | 215.67 g/mol |
| IUPAC name | ethyl 4-(aminomethyl)benzoate;hydrochloride |
| InChIKey | KMZNTLYGVGINKN-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC=C(C=C1)CN.Cl |
Computed by PubChem (NCBI)
Synonyms:
4-Aminomethyl-benzoic acid ethyl ester hydrochloride, ethyl 4-(aminomethyl)benzoate hydrochloride, Ethyl 4-(aminomethyl)benzoate HCl, ethyl 4-(aminomethyl)benzoate;hydrochloride, Benzoic acid, 4-(aminomethyl)-, ethyl ester, hydrochloride (1, 4-(Aminomethyl)benzoic acid ethyl ester HCl, 4-(Aminomethyl)-benzoic acid ethyl ester HCl, ethyl4-(aminomethyl)benzoatehydrochloride, 4-Aminomethylbenzoic acid-ethylester hydrochloride, Ethyl 4-(aminomethyl)benzoate--hydrogen chloride (1
