Products 6232-12-8
CAS 6232-12-8 appears in our catalog under these names: Ethyl 4-(aminomethyl)benzoate hydrochloride, 97%, ETHYL 4-(AMINOMETHYL)BENZOATE HCL, 98%. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 25g, 10g.
Ethyl 4-(aminomethyl)benzoate;hydrochloride (CAS 6232-12-8) is a chemical compound with the molecular formula C10H14ClNO2 and a molecular weight of 215.67 g/mol. IUPAC name: ethyl 4-(aminomethyl)benzoate;hydrochloride. InChIKey: KMZNTLYGVGINKN-UHFFFAOYSA-N.
| Molecular formula | C10H14ClNO2 |
|---|---|
| Molecular weight | 215.67 g/mol |
| IUPAC name | ethyl 4-(aminomethyl)benzoate;hydrochloride |
| InChIKey | KMZNTLYGVGINKN-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC=C(C=C1)CN.Cl |
Computed by PubChem (NCBI)
Synonyms:
4-Aminomethyl-benzoic acid ethyl ester hydrochloride, ethyl 4-(aminomethyl)benzoate hydrochloride, Ethyl 4-(aminomethyl)benzoate HCl, ethyl 4-(aminomethyl)benzoate;hydrochloride, Benzoic acid, 4-(aminomethyl)-, ethyl ester, hydrochloride (1, 4-(Aminomethyl)benzoic acid ethyl ester HCl, 4-(Aminomethyl)-benzoic acid ethyl ester HCl, ethyl4-(aminomethyl)benzoatehydrochloride, 4-Aminomethylbenzoic acid-ethylester hydrochloride, Ethyl 4-(aminomethyl)benzoate--hydrogen chloride (1