cas: 87081-52-5 — see every product listed under this CAS number, including other names
Ethyl 4-Amino-3-hydroxybenzoate, 97% (CAS 87081-52-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F402937-250MG |
| cas | 87081-52-5 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 133.30 Pln | |
| Fluorochem | 1g | 253.05 Pln | |
| Fluorochem | 5g | 830.98 Pln | |
| Fluorochem | 10g | 1565.09 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Ethyl 4-amino-3-hydroxybenzoate (CAS 87081-52-5) is a chemical compound with the molecular formula C9H11NO3 and a molecular weight of 181.19 g/mol. IUPAC name: ethyl 4-amino-3-hydroxybenzoate. InChIKey: SVLMEEHRAATUJY-UHFFFAOYSA-N.
| Molecular formula | C9H11NO3 |
|---|---|
| Molecular weight | 181.19 g/mol |
| IUPAC name | ethyl 4-amino-3-hydroxybenzoate |
| InChIKey | SVLMEEHRAATUJY-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=C(C=C1)N)O |
Computed by PubChem (NCBI)