cas: 119647-73-3 — see every product listed under this CAS number, including other names
Ethyl 7-Oxo-4,5,6,7-tetrahydro-1H-indole-2-carboxylate, 95%, 95% (CAS 119647-73-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HF44-100mg |
| cas | 119647-73-3 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 208.40 Pln | |
| Chemat | 250mg | 357.20 Pln | |
| Chemat | 1g | 880.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Ethyl 7-oxo-1,4,5,6-tetrahydroindole-2-carboxylate (CAS 119647-73-3) is a chemical compound with the molecular formula C11H13NO3 and a molecular weight of 207.23 g/mol. IUPAC name: ethyl 7-oxo-1,4,5,6-tetrahydroindole-2-carboxylate. InChIKey: FRUNPDDVIUSYEQ-UHFFFAOYSA-N.
| Molecular formula | C11H13NO3 |
|---|---|
| Molecular weight | 207.23 g/mol |
| IUPAC name | ethyl 7-oxo-1,4,5,6-tetrahydroindole-2-carboxylate |
| InChIKey | FRUNPDDVIUSYEQ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC2=C(N1)C(=O)CCC2 |
Computed by PubChem (NCBI)