cas: 119647-73-3 — see every product listed under this CAS number, including other names
Ethyl 7-oxo-4,5,6,7-tetrahydro-1H-indole-2-carboxylate 95% (CAS 119647-73-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A215854-100mg |
| cas | 119647-73-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 320.31 Pln | |
| Ambeed | 250mg | 426.00 Pln | |
| Ambeed | 1g | 1065.69 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A215854 |
Ethyl 7-oxo-1,4,5,6-tetrahydroindole-2-carboxylate (CAS 119647-73-3) is a chemical compound with the molecular formula C11H13NO3 and a molecular weight of 207.23 g/mol. IUPAC name: ethyl 7-oxo-1,4,5,6-tetrahydroindole-2-carboxylate. InChIKey: FRUNPDDVIUSYEQ-UHFFFAOYSA-N.
| Molecular formula | C11H13NO3 |
|---|---|
| Molecular weight | 207.23 g/mol |
| IUPAC name | ethyl 7-oxo-1,4,5,6-tetrahydroindole-2-carboxylate |
| InChIKey | FRUNPDDVIUSYEQ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC2=C(N1)C(=O)CCC2 |
Computed by PubChem (NCBI)