cas: 1499-53-2 — see every product listed under this CAS number, including other names
Ethyl Hippurate 95+% (CAS 1499-53-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A861984-1g |
| cas | 1499-53-2 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 120.06 Pln | |
| Ambeed | 5g | 131.19 Pln | |
| Ambeed | 25g | 248.00 Pln | |
| Ambeed | 100g | 565.06 Pln |
| purity | 95+% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A861984 |
Ethyl 2-benzamidoacetate (CAS 1499-53-2) is a chemical compound with the molecular formula C11H13NO3 and a molecular weight of 207.23 g/mol. IUPAC name: ethyl 2-benzamidoacetate. InChIKey: PTXRQIPIELXJFH-UHFFFAOYSA-N.
| Molecular formula | C11H13NO3 |
|---|---|
| Molecular weight | 207.23 g/mol |
| IUPAC name | ethyl 2-benzamidoacetate |
| InChIKey | PTXRQIPIELXJFH-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CNC(=O)C1=CC=CC=C1 |
Computed by PubChem (NCBI)