CAS 113143-13-8 appears in our catalog under these names: FGF22-IN-1/ 99.18% (existing batch purity), FGF22–IN–1, FGF22-IN-1, ≥98%, ≥98%, FGF22-IN-1, 98.07%. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 5 mg.
N-[(E)-1H-indol-3-ylmethylideneamino]thiophene-2-carboxamide (CAS 113143-13-8) is a chemical compound with the molecular formula C14H11N3OS and a molecular weight of 269.32 g/mol. IUPAC name: N-[(E)-1H-indol-3-ylmethylideneamino]thiophene-2-carboxamide. InChIKey: FMKAYIUNMIHSEK-CXUHLZMHSA-N.
| Molecular formula | C14H11N3OS |
|---|---|
| Molecular weight | 269.32 g/mol |
| IUPAC name | N-[(E)-1H-indol-3-ylmethylideneamino]thiophene-2-carboxamide |
| InChIKey | FMKAYIUNMIHSEK-CXUHLZMHSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN2)/C=N/NC(=O)C3=CC=CS3 |
Computed by PubChem (NCBI)