cas: 186320-18-3 — see every product listed under this CAS number, including other names
FMOC-DL-3-AMINOBUTYRIC ACID, 98% (CAS 186320-18-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F863362-100MG |
| cas | 186320-18-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 513.38 Pln | |
| Fluorochem | 250mg | 862.21 Pln | |
| Fluorochem | 1g | 2215.90 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
3-(9H-fluoren-9-ylmethoxycarbonylamino)butanoic acid (CAS 186320-18-3) is a chemical compound with the molecular formula C19H19NO4 and a molecular weight of 325.4 g/mol. IUPAC name: 3-(9H-fluoren-9-ylmethoxycarbonylamino)butanoic acid. InChIKey: LYMLSPRRJWJJQD-UHFFFAOYSA-N.
| Molecular formula | C19H19NO4 |
|---|---|
| Molecular weight | 325.4 g/mol |
| IUPAC name | 3-(9H-fluoren-9-ylmethoxycarbonylamino)butanoic acid |
| InChIKey | LYMLSPRRJWJJQD-UHFFFAOYSA-N |
| SMILES | CC(CC(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)