cas: 193954-26-6 — see every product listed under this CAS number, including other names
Fmoc-β-HoAla-OH 97% (CAS 193954-26-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A243664-100mg |
| cas | 193954-26-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 142.31 Pln | |
| Ambeed | 250mg | 159.00 Pln | |
| Ambeed | 1g | 181.25 Pln | |
| Ambeed | 5g | 337.00 Pln | |
| Ambeed | 25g | 1354.94 Pln | |
| Ambeed | 100g | 5198.62 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A243664 |
(3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)butanoic acid (CAS 193954-26-6) is a chemical compound with the molecular formula C19H19NO4 and a molecular weight of 325.4 g/mol. IUPAC name: (3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)butanoic acid. InChIKey: LYMLSPRRJWJJQD-LBPRGKRZSA-N.
| Molecular formula | C19H19NO4 |
|---|---|
| Molecular weight | 325.4 g/mol |
| IUPAC name | (3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)butanoic acid |
| InChIKey | LYMLSPRRJWJJQD-LBPRGKRZSA-N |
| SMILES | C[C@@H](CC(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)