cas: 193954-26-6 — see every product listed under this CAS number, including other names
fmoc-b-Homoalanine, 96% (CAS 193954-26-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 250mg, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F045385-1G |
| cas | 193954-26-6 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 122.89 Pln | |
| Fluorochem | 250mg | 122.89 Pln | |
| Fluorochem | 5g | 320.74 Pln | |
| Fluorochem | 10g | 581.06 Pln | |
| Fluorochem | 25g | 1190.22 Pln | |
| Fluorochem | 100g | 4590.07 Pln |
| purity | 96% |
|---|---|
| delivery time | 1-2 weeks |
(3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)butanoic acid (CAS 193954-26-6) is a chemical compound with the molecular formula C19H19NO4 and a molecular weight of 325.4 g/mol. IUPAC name: (3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)butanoic acid. InChIKey: LYMLSPRRJWJJQD-LBPRGKRZSA-N.
| Molecular formula | C19H19NO4 |
|---|---|
| Molecular weight | 325.4 g/mol |
| IUPAC name | (3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)butanoic acid |
| InChIKey | LYMLSPRRJWJJQD-LBPRGKRZSA-N |
| SMILES | C[C@@H](CC(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)