cas: 886510-13-0 — see every product listed under this CAS number, including other names
Fmoc-3-hydroxyazetidine (CAS 886510-13-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F032716-1G |
| cas | 886510-13-0 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 424.87 Pln | |
| Fluorochem | 5g | 1549.47 Pln |
| delivery time | 2-3 weeks |
|---|
9H-fluoren-9-ylmethyl 3-hydroxyazetidine-1-carboxylate (CAS 886510-13-0) is a chemical compound with the molecular formula C18H17NO3 and a molecular weight of 295.3 g/mol. IUPAC name: 9H-fluoren-9-ylmethyl 3-hydroxyazetidine-1-carboxylate. InChIKey: YAEMQXJRXHCWDV-UHFFFAOYSA-N.
| Molecular formula | C18H17NO3 |
|---|---|
| Molecular weight | 295.3 g/mol |
| IUPAC name | 9H-fluoren-9-ylmethyl 3-hydroxyazetidine-1-carboxylate |
| InChIKey | YAEMQXJRXHCWDV-UHFFFAOYSA-N |
| SMILES | C1C(CN1C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)O |
Computed by PubChem (NCBI)