cas: 127273-06-7 — see every product listed under this CAS number, including other names
Fmoc-Ala(CN)-OH 97% (CAS 127273-06-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A665572-250mg |
| cas | 127273-06-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 331.44 Pln | |
| Ambeed | 1g | 381.50 Pln | |
| Ambeed | 5g | 1010.06 Pln | |
| Ambeed | 25g | 3274.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A665572 |
(2S)-3-cyano-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid (CAS 127273-06-7) is a chemical compound with the molecular formula C19H16N2O4 and a molecular weight of 336.3 g/mol. IUPAC name: (2S)-3-cyano-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid. InChIKey: FJSOTHAUCCEZLI-KRWDZBQOSA-N.
| Molecular formula | C19H16N2O4 |
|---|---|
| Molecular weight | 336.3 g/mol |
| IUPAC name | (2S)-3-cyano-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
| InChIKey | FJSOTHAUCCEZLI-KRWDZBQOSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H](CC#N)C(=O)O |
Computed by PubChem (NCBI)