Fmoc-Aze-OH 97%
cas: 136552-06-2 — see every product listed under this CAS number, including other names
Fmoc-Aze-OH 97% (CAS 136552-06-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A862109-250mg |
| cas | 136552-06-2 |
| size | 250mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 203.50 Pln | |
| Ambeed | 1g | 225.75 Pln | |
| Ambeed | 5g | 487.19 Pln | |
| Ambeed | 10g | 726.38 Pln | |
| Ambeed | 25g | 1377.19 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A862109 |
(2S)-1-(9H-fluoren-9-ylmethoxycarbonyl)azetidine-2-carboxylic acid (CAS 136552-06-2) is a chemical compound with the molecular formula C19H17NO4 and a molecular weight of 323.3 g/mol. IUPAC name: (2S)-1-(9H-fluoren-9-ylmethoxycarbonyl)azetidine-2-carboxylic acid. InChIKey: BXRZCDISGRVJCA-KRWDZBQOSA-N.
| Molecular formula | C19H17NO4 |
|---|---|
| Molecular weight | 323.3 g/mol |
| IUPAC name | (2S)-1-(9H-fluoren-9-ylmethoxycarbonyl)azetidine-2-carboxylic acid |
| InChIKey | BXRZCDISGRVJCA-KRWDZBQOSA-N |
| SMILES | C1CN([C@@H]1C(=O)O)C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)
Synonyms:
(S)-N-Fmoc-azetidine-2-carboxylic acid, (S)-1-(((9H-Fluoren-9-yl)methoxy)carbonyl)azetidine-2-carboxylic acid, 1-Fmoc-(S)-azetidine-2-carboxylic acid, Fmoc-Aze-OH, (2S)-1-(9H-fluoren-9-ylmethoxycarbonyl)azetidine-2-carboxylic acid, Fmoc-L-azetidine-2-carboxylic acid, Fmoc-Aze(2)-OH, fmoc-azetidine-2-carboxylic acid, BXRZCDISGRVJCA-KRWDZBQOSA-N, (2S)-1-{[(9H-fluoren-9-yl)methoxy]carbonyl}azetidine-2-carboxylic acid