cas: 201864-71-3 — see every product listed under this CAS number, including other names
Fmoc-D-β-HomoAla-OH 98% (CAS 201864-71-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A251664-1g |
| cas | 201864-71-3 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 153.44 Pln | |
| Ambeed | 5g | 481.62 Pln | |
| Ambeed | 10g | 648.50 Pln | |
| Ambeed | 25g | 1160.25 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A251664 |
(3R)-3-(9H-fluoren-9-ylmethoxycarbonylamino)butanoic acid (CAS 201864-71-3) is a chemical compound with the molecular formula C19H19NO4 and a molecular weight of 325.4 g/mol. IUPAC name: (3R)-3-(9H-fluoren-9-ylmethoxycarbonylamino)butanoic acid. InChIKey: LYMLSPRRJWJJQD-GFCCVEGCSA-N.
| Molecular formula | C19H19NO4 |
|---|---|
| Molecular weight | 325.4 g/mol |
| IUPAC name | (3R)-3-(9H-fluoren-9-ylmethoxycarbonylamino)butanoic acid |
| InChIKey | LYMLSPRRJWJJQD-GFCCVEGCSA-N |
| SMILES | C[C@H](CC(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)