Fmoc-D-Gly(allyl)-OH, 99.98%
cas: 170642-28-1 — see every product listed under this CAS number, including other names
Fmoc-D-Gly(allyl)-OH, 99.98% (CAS 170642-28-1) is a chemical reagent available from Chemat. Available pack sizes: 10 g, 25 g, 5 g, 1 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-W013779-10 g |
| cas | 170642-28-1 |
| size | 10 g |
| availability | In stock |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 10 g | 872.33 Pln | |
| MedChemExpress | 25 g | 1606.08 Pln | |
| MedChemExpress | 5 g | 519.38 Pln | |
| MedChemExpress | 1 g | 305.76 Pln |
properties
| delivery time | 2-3 weeks |
|---|---|
| purity | 99.98% |
(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)pent-4-enoic acid (CAS 170642-28-1) is a chemical compound with the molecular formula C20H19NO4 and a molecular weight of 337.4 g/mol. IUPAC name: (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)pent-4-enoic acid. InChIKey: YVBLQCANYSFEBN-GOSISDBHSA-N.
| Molecular formula | C20H19NO4 |
|---|---|
| Molecular weight | 337.4 g/mol |
| IUPAC name | (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)pent-4-enoic acid |
| InChIKey | YVBLQCANYSFEBN-GOSISDBHSA-N |
| SMILES | C=CC[C@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)
Synonyms:
Fmoc-D-Allylglycine, fmoc-d-gly(allyl)-oh, Fmoc-D-allyl-Gly-OH, (R)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)pent-4-enoic acid, (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)pent-4-enoic acid, (R)-N-Fmoc-Allylglycine, Fmoc-(R)-2-Allylglycine, Fmoc-D-Allyglycine, (2R)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)pent-4-enoic acid, Fmoc-alpha-allyl-D-Gly-OH