cas: 170642-28-1 — see every product listed under this CAS number, including other names
Fmoc–α–allyl–D–Gly–OH (CAS 170642-28-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 10g, 25g, 5g. Offered by: GLPBio.
| brand | GLPBio |
|---|---|
| catalog number | GA21842-1000 |
| cas | 170642-28-1 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| GLPBio | 1g | 976.16 Pln | |
| GLPBio | 10g | 1556.54 Pln | |
| GLPBio | 25g | 2436.48 Pln | |
| GLPBio | 5g | 1256.99 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)pent-4-enoic acid (CAS 170642-28-1) is a chemical compound with the molecular formula C20H19NO4 and a molecular weight of 337.4 g/mol. IUPAC name: (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)pent-4-enoic acid. InChIKey: YVBLQCANYSFEBN-GOSISDBHSA-N.
| Molecular formula | C20H19NO4 |
|---|---|
| Molecular weight | 337.4 g/mol |
| IUPAC name | (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)pent-4-enoic acid |
| InChIKey | YVBLQCANYSFEBN-GOSISDBHSA-N |
| SMILES | C=CC[C@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)