CAS 146549-21-5 appears in our catalog under these names: Fmoc-L-allylglycine, Fmoc–Gly(allyl)–OH, Fmoc-L-AllylGly-OH, 2-Allyl-N-Fmoc-L-glycine, 95% , Fmoc-Gly(allyl)-OH 97%. Offered by: TRC, GLPBio, Iris Biotech, Thermo Scientific (Alfa Aesar), Biosynth. Available pack sizes: 1g, 25g, 5g, 10g, 50g, 100g, 500g, 250mg.
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)pent-4-enoic acid (CAS 146549-21-5) is a chemical compound with the molecular formula C20H19NO4 and a molecular weight of 337.4 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)pent-4-enoic acid. InChIKey: YVBLQCANYSFEBN-SFHVURJKSA-N.
| Molecular formula | C20H19NO4 |
|---|---|
| Molecular weight | 337.4 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)pent-4-enoic acid |
| InChIKey | YVBLQCANYSFEBN-SFHVURJKSA-N |
| SMILES | C=CC[C@@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)