cas: 146549-21-5 — see every product listed under this CAS number, including other names
Fmoc-Gly(allyl)-OH, 99.98% (CAS 146549-21-5) is a chemical reagent available from Chemat. Available pack sizes: 10 g, 1 g, 25 g, 5 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-W008560-10 g |
| cas | 146549-21-5 |
| size | 10 g |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 10 g | 793.38 Pln | |
| MedChemExpress | 1 g | 287.18 Pln | |
| MedChemExpress | 25 g | 1462.12 Pln | |
| MedChemExpress | 5 g | 542.60 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 99.98% |
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)pent-4-enoic acid (CAS 146549-21-5) is a chemical compound with the molecular formula C20H19NO4 and a molecular weight of 337.4 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)pent-4-enoic acid. InChIKey: YVBLQCANYSFEBN-SFHVURJKSA-N.
| Molecular formula | C20H19NO4 |
|---|---|
| Molecular weight | 337.4 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)pent-4-enoic acid |
| InChIKey | YVBLQCANYSFEBN-SFHVURJKSA-N |
| SMILES | C=CC[C@@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)