cas: 146549-21-5 — see every product listed under this CAS number, including other names
Fmoc-L-Allylglycine, 98%, 98% (CAS 146549-21-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 50g, 100g, 250g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112E4Y-250mg |
| cas | 146549-21-5 |
| size | 250mg |
| availability | 10000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 98.00 Pln | |
| Chemat | 5g | 213.20 Pln | |
| Chemat | 10g | 338.00 Pln | |
| Chemat | 25g | 611.60 Pln | |
| Chemat | 50g | 1062.80 Pln | |
| Chemat | 100g | 1922.00 Pln | |
| Chemat | 250g | 4336.40 Pln | |
| Chemat | 1kg | 7557.20 Pln | |
| Chemat | 5kg | 34435.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)pent-4-enoic acid (CAS 146549-21-5) is a chemical compound with the molecular formula C20H19NO4 and a molecular weight of 337.4 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)pent-4-enoic acid. InChIKey: YVBLQCANYSFEBN-SFHVURJKSA-N.
| Molecular formula | C20H19NO4 |
|---|---|
| Molecular weight | 337.4 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)pent-4-enoic acid |
| InChIKey | YVBLQCANYSFEBN-SFHVURJKSA-N |
| SMILES | C=CC[C@@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)