cas: 173212-86-7 — see every product listed under this CAS number, including other names
Fmoc-Hse(Me)-OH 98% (CAS 173212-86-7) is a chemical reagent available from Chemat. Available pack sizes: 100g, 100mg, 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A152750-100g |
| cas | 173212-86-7 |
| size | 100g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100g | 24873.19 Pln | |
| Ambeed | 100mg | 220.19 Pln | |
| Ambeed | 250mg | 253.56 Pln | |
| Ambeed | 1g | 481.62 Pln | |
| Ambeed | 5g | 1888.94 Pln | |
| Ambeed | 25g | 7824.12 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A152750 |
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-methoxybutanoic acid (CAS 173212-86-7) is a chemical compound with the molecular formula C20H21NO5 and a molecular weight of 355.4 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-methoxybutanoic acid. InChIKey: JBIRUWVMQYLPPX-SFHVURJKSA-N.
| Molecular formula | C20H21NO5 |
|---|---|
| Molecular weight | 355.4 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-methoxybutanoic acid |
| InChIKey | JBIRUWVMQYLPPX-SFHVURJKSA-N |
| SMILES | COCC[C@@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)