cas: 198561-07-8 — see every product listed under this CAS number, including other names
Fmoc-L-Propargylglycine, 98% (CAS 198561-07-8) is a chemical reagent available from Chemat. Available pack sizes: 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113BML-10g |
| cas | 198561-07-8 |
| size | 10g |
| availability | 1000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 10g | 342.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)pent-4-ynoic acid (CAS 198561-07-8) is a chemical compound with the molecular formula C20H17NO4 and a molecular weight of 335.4 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)pent-4-ynoic acid. InChIKey: DJGMNCKHNMRKFM-SFHVURJKSA-N.
| Molecular formula | C20H17NO4 |
|---|---|
| Molecular weight | 335.4 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)pent-4-ynoic acid |
| InChIKey | DJGMNCKHNMRKFM-SFHVURJKSA-N |
| SMILES | C#CC[C@@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)