cas: 35661-60-0 — see every product listed under this CAS number, including other names
Fmoc-L-leucine, 98%, 98% (CAS 35661-60-0) is a chemical reagent available from Chemat. Available pack sizes: 10kg, 5g, 10g, 50g, 250g, 500g, 1kg, 5kg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11I83W-10kg |
| cas | 35661-60-0 |
| size | 10kg |
| availability | 25000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 10kg | price on request | |
| Chemat | 5g | 74.00 Pln | |
| Chemat | 10g | 74.00 Pln | |
| Chemat | 50g | 107.60 Pln | |
| Chemat | 250g | 270.80 Pln | |
| Chemat | 500g | 508.80 Pln | |
| Chemat | 1kg | 870.80 Pln | |
| Chemat | 5kg | 3417.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-methylpentanoic acid (CAS 35661-60-0) is a chemical compound with the molecular formula C21H23NO4 and a molecular weight of 353.4 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-methylpentanoic acid. InChIKey: CBPJQFCAFFNICX-IBGZPJMESA-N.
| Molecular formula | C21H23NO4 |
|---|---|
| Molecular weight | 353.4 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-methylpentanoic acid |
| InChIKey | CBPJQFCAFFNICX-IBGZPJMESA-N |
| SMILES | CC(C)C[C@@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)