Products 1190594-22-9
CAS 1190594-22-9 appears in our catalog under these names: Fmoc-(D10)Leu-OH, L-Leucine-d10-N-FMOC, 98 atom % D, min 98% Chemical Purity, Fmoc-leucine-d10, 99.40%. Offered by: Creative Peptides, CDN, Biosynth, MedChemExpress. Available pack sizes: 0,5g, 1g, 0,25g, 0,1g, 25mg, 10mg, 50mg, 100mg.
(2S)-2,3,3,4,5,5,5-heptadeuterio-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-(trideuteriomethyl)pentanoic acid (CAS 1190594-22-9) is a chemical compound with the molecular formula C21H23NO4 and a molecular weight of 363.5 g/mol. IUPAC name: (2S)-2,3,3,4,5,5,5-heptadeuterio-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-(trideuteriomethyl)pentanoic acid. InChIKey: CBPJQFCAFFNICX-QDXFTFMQSA-N.
| Molecular formula | C21H23NO4 |
|---|---|
| Molecular weight | 363.5 g/mol |
| IUPAC name | (2S)-2,3,3,4,5,5,5-heptadeuterio-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-(trideuteriomethyl)pentanoic acid |
| InChIKey | CBPJQFCAFFNICX-QDXFTFMQSA-N |
| SMILES | [2H][C@@](C(=O)O)(C([2H])([2H])C([2H])(C([2H])([2H])[2H])C([2H])([2H])[2H])NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)