Products 1163133-36-5
CAS 1163133-36-5 appears in our catalog under these names: Fmoc-Leu-OH-13C6,15N, Fmoc-leucine-13C6,15N 95%, Fmoc-leucine-13C6,15N, 99.90%. Offered by: TRC, Ambeed, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 250mg, 5 mg, 1 mg.
(2S)-2-(9H-fluoren-9-ylmethoxycarbonyl(15N)amino)-4-(113C)methyl(1,2,3,4,5-13C5)pentanoic acid (CAS 1163133-36-5) is a chemical compound with the molecular formula C21H23NO4 and a molecular weight of 360.36 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonyl(15N)amino)-4-(113C)methyl(1,2,3,4,5-13C5)pentanoic acid. InChIKey: CBPJQFCAFFNICX-HNIVWWTASA-N.
| Molecular formula | C21H23NO4 |
|---|---|
| Molecular weight | 360.36 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonyl(15N)amino)-4-(113C)methyl(1,2,3,4,5-13C5)pentanoic acid |
| InChIKey | CBPJQFCAFFNICX-HNIVWWTASA-N |
| SMILES | [13CH3][13CH]([13CH3])[13CH2][13C@@H]([13C](=O)O)[15NH]C(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)