CAS 202114-53-2 is the registry number for Fmoc-leucine-13C, 99.90%. Offered by: MedChemExpress. Available pack sizes: 25 mg, 100 mg, 10 mg, 500 mg, 50 mg, 250 mg, 5 mg.
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-methyl(113C)pentanoic acid (CAS 202114-53-2) is a chemical compound with the molecular formula C21H23NO4 and a molecular weight of 354.4 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-methyl(113C)pentanoic acid. InChIKey: CBPJQFCAFFNICX-CHPITSPMSA-N.
| Molecular formula | C21H23NO4 |
|---|---|
| Molecular weight | 354.4 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-methyl(113C)pentanoic acid |
| InChIKey | CBPJQFCAFFNICX-CHPITSPMSA-N |
| SMILES | CC(C)C[C@@H]([13C](=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)