CAS 200937-57-1 appears in our catalog under these names: Fmoc–leucine–15N, Fmoc-(15N)Leu-OH, FMOC-LEU-OH-15N, 98 ATOM % 15N, 98% CP, Fmoc-leucine-15N, 98.5%. Offered by: GLPBio, Biosynth, Sigma-Aldrich, MedChemExpress. Available pack sizes: 100mg, 500mg, 250mg, 1000mg, 1G, 25 mg, 100 mg, 50 mg.
(2S)-2-(9H-fluoren-9-ylmethoxycarbonyl(15N)amino)-4-methylpentanoic acid (CAS 200937-57-1) is a chemical compound with the molecular formula C21H23NO4 and a molecular weight of 354.4 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonyl(15N)amino)-4-methylpentanoic acid. InChIKey: CBPJQFCAFFNICX-VIKCBUFNSA-N.
| Molecular formula | C21H23NO4 |
|---|---|
| Molecular weight | 354.4 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonyl(15N)amino)-4-methylpentanoic acid |
| InChIKey | CBPJQFCAFFNICX-VIKCBUFNSA-N |
| SMILES | CC(C)C[C@@H](C(=O)O)[15NH]C(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)