cas: 1310680-42-2 — see every product listed under this CAS number, including other names
Fmoc-N-(propyl)-glycine, 98%, 98% (CAS 1310680-42-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HSCX-250mg |
| cas | 1310680-42-2 |
| size | 250mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 126.80 Pln | |
| Chemat | 1g | 227.60 Pln | |
| Chemat | 5g | 640.40 Pln | |
| Chemat | 10g | 1106.00 Pln | |
| Chemat | 25g | 2094.80 Pln | |
| Chemat | 100mg | 122.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-[9H-fluoren-9-ylmethoxycarbonyl(propyl)amino]acetic acid (CAS 1310680-42-2) is a chemical compound with the molecular formula C20H21NO4 and a molecular weight of 339.4 g/mol. IUPAC name: 2-[9H-fluoren-9-ylmethoxycarbonyl(propyl)amino]acetic acid. InChIKey: VSSPPCXYCLZPJC-UHFFFAOYSA-N.
| Molecular formula | C20H21NO4 |
|---|---|
| Molecular weight | 339.4 g/mol |
| IUPAC name | 2-[9H-fluoren-9-ylmethoxycarbonyl(propyl)amino]acetic acid |
| InChIKey | VSSPPCXYCLZPJC-UHFFFAOYSA-N |
| SMILES | CCCN(CC(=O)O)C(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)