cas: 299430-87-8 — see every product listed under this CAS number, including other names
Fmoc-N-amido-PEG2-alcohol 98% (CAS 299430-87-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A823086-1g |
| cas | 299430-87-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 220.19 Pln | |
| Ambeed | 5g | 342.56 Pln | |
| Ambeed | 25g | 1427.25 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A823086 |
9H-fluoren-9-ylmethyl N-[2-(2-hydroxyethoxy)ethyl]carbamate (CAS 299430-87-8) is a chemical compound with the molecular formula C19H21NO4 and a molecular weight of 327.4 g/mol. IUPAC name: 9H-fluoren-9-ylmethyl N-[2-(2-hydroxyethoxy)ethyl]carbamate. InChIKey: DUVHQSUZTXSLMW-UHFFFAOYSA-N.
| Molecular formula | C19H21NO4 |
|---|---|
| Molecular weight | 327.4 g/mol |
| IUPAC name | 9H-fluoren-9-ylmethyl N-[2-(2-hydroxyethoxy)ethyl]carbamate |
| InChIKey | DUVHQSUZTXSLMW-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NCCOCCO |
Computed by PubChem (NCBI)