cas: 199006-54-7 — see every product listed under this CAS number, including other names
Fmoc-Phe(4-Me)-OH 97% (CAS 199006-54-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A280810-250mg |
| cas | 199006-54-7 |
| size | 250mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 125.62 Pln | |
| Ambeed | 1g | 214.62 Pln | |
| Ambeed | 5g | 292.50 Pln | |
| Ambeed | 10g | 442.69 Pln | |
| Ambeed | 25g | 993.38 Pln | |
| Ambeed | 100g | 3418.62 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A280810 |
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(4-methylphenyl)propanoic acid (CAS 199006-54-7) is a chemical compound with the molecular formula C25H23NO4 and a molecular weight of 401.5 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(4-methylphenyl)propanoic acid. InChIKey: UXLHLZHGQPDMJQ-QHCPKHFHSA-N.
| Molecular formula | C25H23NO4 |
|---|---|
| Molecular weight | 401.5 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(4-methylphenyl)propanoic acid |
| InChIKey | UXLHLZHGQPDMJQ-QHCPKHFHSA-N |
| SMILES | CC1=CC=C(C=C1)C[C@@H](C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)