Fmoc-Ser-OH, 98% (contains 3% EA)
cas: 73724-45-5 — see every product listed under this CAS number, including other names
Fmoc-Ser-OH, 98% (contains 3% EA) (CAS 73724-45-5) is a chemical reagent available from Chemat. Available pack sizes: 10g, 25g, 100g, 500g, 1kg, 1g, 5g. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A114508-10g |
| cas | 73724-45-5 |
| size | 10g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 10g | 225.75 Pln | |
| Ambeed | 25g | 253.56 Pln | |
| Ambeed | 100g | 342.56 Pln | |
| Ambeed | 500g | 1265.94 Pln | |
| Ambeed | 1kg | 2105.88 Pln | |
| BLDpharm | 1g | 186.63 Pln | |
| BLDpharm | 5g | 208.84 Pln | |
| BLDpharm | 10g | 236.61 Pln | |
| BLDpharm | 25g | 269.93 Pln | |
| BLDpharm | 100g | 358.79 Pln | |
| BLDpharm | 500g | 1358.44 Pln | |
| BLDpharm | 1kg | 2269.23 Pln |
properties
| purity | 98% (contains 3% EA) |
|---|---|
| delivery time | 1-2 weeks |
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-hydroxypropanoic acid (CAS 73724-45-5) is a chemical compound with the molecular formula C18H17NO5 and a molecular weight of 327.3 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-hydroxypropanoic acid. InChIKey: JZTKZVJMSCONAK-INIZCTEOSA-N.
| Molecular formula | C18H17NO5 |
|---|---|
| Molecular weight | 327.3 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-hydroxypropanoic acid |
| InChIKey | JZTKZVJMSCONAK-INIZCTEOSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H](CO)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
(2S)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-3-hydroxypropanoic acid, (2S)-2-((((9H-fluoren-9-yl)methoxy)carbonyl)amino)-3-hydroxypropanoic acid, (2S)-2-([[(9H-Fluoren-9-yl)methoxy]carbonyl]amino)-3-hydroxypropanoic acid, Fmoc-Ser-OH, Fmoc-L-serine, Fmoc-L-Ser-OH, N-Fmoc-L-serine, (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-hydroxypropanoic acid, (((9H-Fluoren-9-yl)methoxy)carbonyl)-L-serine, Fmoc-Ser-OH H2O
