Products 1380308-48-4
CAS 1380308-48-4 appears in our catalog under these names: L-Serine-2,3,3-d3-N-FMOC, 98 atom % D, min 98% Chemical Purity, Fmoc–Ser–OH–d3, Fmoc-Ser-OH-d3, 99.0%. Offered by: CDN, GLPBio, MedChemExpress. Available pack sizes: 0,1g, 0,05g, 10mg, 5mg, 1 mg, 10 mg, 5 mg.
(2S)-2,3,3-trideuterio-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-hydroxypropanoic acid (CAS 1380308-48-4) is a chemical compound with the molecular formula C18H17NO5 and a molecular weight of 330.3 g/mol. IUPAC name: (2S)-2,3,3-trideuterio-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-hydroxypropanoic acid. InChIKey: JZTKZVJMSCONAK-BUYVNXHGSA-N.
| Molecular formula | C18H17NO5 |
|---|---|
| Molecular weight | 330.3 g/mol |
| IUPAC name | (2S)-2,3,3-trideuterio-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-hydroxypropanoic acid |
| InChIKey | JZTKZVJMSCONAK-BUYVNXHGSA-N |
| SMILES | [2H][C@@](C(=O)O)(C([2H])([2H])O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)
Synonyms:
Fmoc-Ser-OH-d3, L-Serine-2,3,3-d3-N-FMOC